C31H34N2O6 — CID 102132313
tert-butyl 2-[2-(1-benzoyl-2-oxo-3-prop-2-enoxycarbonylpiperidin-3-yl)ethyl]indole-1-carboxylate (PubChem CID 102132313) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is tert-butyl 2-[2-(1-benzoyl-2-oxo-3-prop-2-enoxycarbonylpiperidin-3-yl)ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(1-benzoyl-2-oxo-3-prop-2-enoxycarbonylpiperidin-3-yl)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 102132313 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl 2-[2-(1-benzoyl-2-oxo-3-prop-2-enoxycarbonylpiperidin-3-yl)ethyl]indole-1-carboxylate |
| SMILES | C=CCOC(=O)C1(CCc2cc3ccccc3n2C(=O)OC(C)(C)C)CCCN(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C31H34N2O6/c1-5-20-38-28(36)31(17-11-19-32(27(31)35)26(34)22-12-7-6-8-13-22)18-16-24-21-23-14-9-10-15-25(23)33(24)29(37)39-30(2,3)4/h5-10,12-15,21H,1,11,16-20H2,2-4H3 |
| InChIKey | PVDSYURIXQHSMN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|