C28H32N2O6 — CID 159647203
1-O-tert-butyl 2-O-prop-2-enyl 2-benzyl-4-(4-methylbenzoyl)-3-oxopiperazine-1,2-dicarboxylate (PubChem CID 159647203) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-prop-2-enyl 2-benzyl-4-(4-methylbenzoyl)-3-oxopiperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-prop-2-enyl 2-benzyl-4-(4-methylbenzoyl)-3-oxopiperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159647203 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-prop-2-enyl 2-benzyl-4-(4-methylbenzoyl)-3-oxopiperazine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)C1(Cc2ccccc2)C(=O)N(C(=O)c2ccc(C)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H32N2O6/c1-6-18-35-25(33)28(19-21-10-8-7-9-11-21)24(32)29(23(31)22-14-12-20(2)13-15-22)16-17-30(28)26(34)36-27(3,4)5/h6-15H,1,16-19H2,2-5H3 |
| InChIKey | MRCKHMDCRHLZPY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|