C20H32N2O7 — CID 159247334
1-O-tert-butyl 2-O-prop-2-enyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopiperidine-1,2-dicarboxylate (PubChem CID 159247334) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-prop-2-enyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-prop-2-enyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159247334 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-prop-2-enyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopiperidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)C1(CNC(=O)OC(C)(C)C)C(=O)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O7/c1-8-12-27-15(24)20(13-21-16(25)28-18(2,3)4)14(23)10-9-11-22(20)17(26)29-19(5,6)7/h8H,1,9-13H2,2-7H3,(H,21,25) |
| InChIKey | TXFGHHNXMAKGSI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|