C48H56N4O6 — CID 160778487
(3S)-4-benzyl-3-methyl-1-(4-methylbenzoyl)-3-prop-2-enylpiperazin-2-one;methane;prop-2-enyl 1-benzyl-2-methyl-4-(4-methylbenzoyl)-3-oxopiperazine-2-carboxylate (PubChem CID 160778487) has the molecular formula C48H56N4O6 and a molecular weight of 785.00 g/mol. Its IUPAC name is (3S)-4-benzyl-3-methyl-1-(4-methylbenzoyl)-3-prop-2-enylpiperazin-2-one;methane;prop-2-enyl 1-benzyl-2-methyl-4-(4-methylbenzoyl)-3-oxopiperazine-2-carboxylate.
| Compound Name | (3S)-4-benzyl-3-methyl-1-(4-methylbenzoyl)-3-prop-2-enylpiperazin-2-one;methane;prop-2-enyl 1-benzyl-2-methyl-4-(4-methylbenzoyl)-3-oxopiperazine-2-carboxylate |
|---|---|
| PubChem CID | 160778487 |
| Molecular Formula | C48H56N4O6 |
| Molecular Weight | 785.00 g/mol |
| Exact Mass | 784.42 |
| IUPAC Name | (3S)-4-benzyl-3-methyl-1-(4-methylbenzoyl)-3-prop-2-enylpiperazin-2-one;methane;prop-2-enyl 1-benzyl-2-methyl-4-(4-methylbenzoyl)-3-oxopiperazine-2-carboxylate |
| SMILES | C.C=CCOC(=O)C1(C)C(=O)N(C(=O)c2ccc(C)cc2)CCN1Cc1ccccc1.C=CC[C@@]1(C)C(=O)N(C(=O)c2ccc(C)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4.C23H26N2O2.CH4/c1-4-16-30-23(29)24(3)22(28)26(21(27)20-12-10-18(2)11-13-20)15-14-25(24)17-19-8-6-5-7-9-19;1-4-14-23(3)22(27)25(21(26)20-12-10-18(2)11-13-20)16-15-24(23)17-19-8-6-5-7-9-19;/h4-13H,1,14-17H2,2-3H3;4-13H,1,14-17H2,2-3H3;1H4/t;23-;/m.0./s1 |
| InChIKey | SAGMUZHGPHYFJC-UUPOELIGSA-N |
| XLogP | 7.42 |
| TPSA | 107.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.00 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|