C16H19NO2 — CID 53495094
(3S)-1-benzoyl-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 53495094) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3S)-1-benzoyl-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S)-1-benzoyl-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 53495094 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3S)-1-benzoyl-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@]1(C)CCCN(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H19NO2/c1-3-10-16(2)11-7-12-17(15(16)19)14(18)13-8-5-4-6-9-13/h3-6,8-9H,1,7,10-12H2,2H3/t16-/m1/s1 |
| InChIKey | OPHBGKKNPZTWSD-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|