C20H27NO3 — CID 146608044
methyl 4-[(3S)-1-benzoyl-3-prop-2-enylpiperidin-3-yl]butanoate (PubChem CID 146608044) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 4-[(3S)-1-benzoyl-3-prop-2-enylpiperidin-3-yl]butanoate.
| Compound Name | methyl 4-[(3S)-1-benzoyl-3-prop-2-enylpiperidin-3-yl]butanoate |
|---|---|
| PubChem CID | 146608044 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl 4-[(3S)-1-benzoyl-3-prop-2-enylpiperidin-3-yl]butanoate |
| SMILES | C=CC[C@]1(CCCC(=O)OC)CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H27NO3/c1-3-12-20(13-7-11-18(22)24-2)14-8-15-21(16-20)19(23)17-9-5-4-6-10-17/h3-6,9-10H,1,7-8,11-16H2,2H3/t20-/m0/s1 |
| InChIKey | DGDRCOWHQBILCQ-FQEVSTJZSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|