C40H58N2O3Si — CID 123903842
1-[3-[[4-[1-benzoyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-prop-2-enylpiperidin-3-yl]phenyl]methyl]-3-prop-2-enylpiperidin-1-yl]ethanone (PubChem CID 123903842) has the molecular formula C40H58N2O3Si and a molecular weight of 643.00 g/mol. Its IUPAC name is 1-[3-[[4-[1-benzoyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-prop-2-enylpiperidin-3-yl]phenyl]methyl]-3-prop-2-enylpiperidin-1-yl]ethanone.
| Compound Name | 1-[3-[[4-[1-benzoyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-prop-2-enylpiperidin-3-yl]phenyl]methyl]-3-prop-2-enylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123903842 |
| Molecular Formula | C40H58N2O3Si |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | 1-[3-[[4-[1-benzoyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-prop-2-enylpiperidin-3-yl]phenyl]methyl]-3-prop-2-enylpiperidin-1-yl]ethanone |
| SMILES | C=CCC1(Cc2ccc(C3CN(C(=O)c4ccccc4)CC(CC=C)(CCO[Si](C)(C)C(C)(C)C)C3)cc2)CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C40H58N2O3Si/c1-9-21-39(23-14-25-41(30-39)32(3)43)27-33-17-19-34(20-18-33)36-28-40(22-10-2,24-26-45-46(7,8)38(4,5)6)31-42(29-36)37(44)35-15-12-11-13-16-35/h9-13,15-20,36H,1-2,14,21-31H2,3-8H3 |
| InChIKey | HSAANNUKQZEZJF-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|