C23H30N2O6 — CID 175731302
tert-butyl (5R)-3-benzoyl-5-(3-methoxy-3-oxopropyl)-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylate (PubChem CID 175731302) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl (5R)-3-benzoyl-5-(3-methoxy-3-oxopropyl)-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylate.
| Compound Name | tert-butyl (5R)-3-benzoyl-5-(3-methoxy-3-oxopropyl)-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 175731302 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl (5R)-3-benzoyl-5-(3-methoxy-3-oxopropyl)-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylate |
| SMILES | C=CC[C@]1(CCC(=O)OC)CN(C(=O)OC(C)(C)C)CN(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H30N2O6/c1-6-13-23(14-12-18(26)30-5)15-24(21(29)31-22(2,3)4)16-25(20(23)28)19(27)17-10-8-7-9-11-17/h6-11H,1,12-16H2,2-5H3/t23-/m0/s1 |
| InChIKey | QCXBQKGYEARVRA-QHCPKHFHSA-N |
| XLogP | 3.38 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|