C24H31N3O5 — CID 175731195
tert-butyl (6R)-6-(2-cyanoethyl)-4-(4-methoxybenzoyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate (PubChem CID 175731195) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl (6R)-6-(2-cyanoethyl)-4-(4-methoxybenzoyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (6R)-6-(2-cyanoethyl)-4-(4-methoxybenzoyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 175731195 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl (6R)-6-(2-cyanoethyl)-4-(4-methoxybenzoyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
| SMILES | C=CC[C@]1(CCC#N)CN(C(=O)OC(C)(C)C)CCN(C(=O)c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C24H31N3O5/c1-6-12-24(13-7-14-25)17-26(22(30)32-23(2,3)4)15-16-27(21(24)29)20(28)18-8-10-19(31-5)11-9-18/h6,8-11H,1,7,12-13,15-17H2,2-5H3/t24-/m0/s1 |
| InChIKey | YGEMDLREYFGHDA-DEOSSOPVSA-N |
| XLogP | 3.78 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|