C25H34N2O7 — CID 175731197
tert-butyl (6R)-4-(4-methoxybenzoyl)-6-(3-methoxy-3-oxopropyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate (PubChem CID 175731197) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is tert-butyl (6R)-4-(4-methoxybenzoyl)-6-(3-methoxy-3-oxopropyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (6R)-4-(4-methoxybenzoyl)-6-(3-methoxy-3-oxopropyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 175731197 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | tert-butyl (6R)-4-(4-methoxybenzoyl)-6-(3-methoxy-3-oxopropyl)-5-oxo-6-prop-2-enyl-1,4-diazepane-1-carboxylate |
| SMILES | C=CC[C@]1(CCC(=O)OC)CN(C(=O)OC(C)(C)C)CCN(C(=O)c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C25H34N2O7/c1-7-13-25(14-12-20(28)33-6)17-26(23(31)34-24(2,3)4)15-16-27(22(25)30)21(29)18-8-10-19(32-5)11-9-18/h7-11H,1,12-17H2,2-6H3/t25-/m0/s1 |
| InChIKey | MNUQLVBLTWPIKV-VWLOTQADSA-N |
| XLogP | 3.43 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|