C23H24N2O5 — CID 154944654
2-benzyl-4-(4-methoxybenzoyl)-3-oxo-2-prop-2-enylpiperazine-1-carboxylic acid (PubChem CID 154944654) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-benzyl-4-(4-methoxybenzoyl)-3-oxo-2-prop-2-enylpiperazine-1-carboxylic acid.
| Compound Name | 2-benzyl-4-(4-methoxybenzoyl)-3-oxo-2-prop-2-enylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154944654 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-benzyl-4-(4-methoxybenzoyl)-3-oxo-2-prop-2-enylpiperazine-1-carboxylic acid |
| SMILES | C=CCC1(Cc2ccccc2)C(=O)N(C(=O)c2ccc(OC)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C23H24N2O5/c1-3-13-23(16-17-7-5-4-6-8-17)21(27)24(14-15-25(23)22(28)29)20(26)18-9-11-19(30-2)12-10-18/h3-12H,1,13-16H2,2H3,(H,28,29) |
| InChIKey | UBMIGDKHOHEFAQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|