C27H23NO4 — CID 134832544
1-acetyl-3-(4-methoxybenzoyl)-6,6-diphenyl-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 134832544) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-acetyl-3-(4-methoxybenzoyl)-6,6-diphenyl-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 1-acetyl-3-(4-methoxybenzoyl)-6,6-diphenyl-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 134832544 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-acetyl-3-(4-methoxybenzoyl)-6,6-diphenyl-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | COc1ccc(C(=O)N2CC3C(C(C)=O)(C2=O)C3(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-18(29)26-23(17-28(25(26)31)24(30)19-13-15-22(32-2)16-14-19)27(26,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,23H,17H2,1-2H3 |
| InChIKey | ZTNDSBBFJOOXKV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|