C20H21N3O3S — CID 10667671
tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methoxyphenyl)prop-2-enylidene]-1,3-thiazolidine-3-carboxylate (PubChem CID 10667671) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methoxyphenyl)prop-2-enylidene]-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methoxyphenyl)prop-2-enylidene]-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10667671 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methoxyphenyl)prop-2-enylidene]-1,3-thiazolidine-3-carboxylate |
| SMILES | COc1ccc(C(/C=C2\SCCN2C(=O)OC(C)(C)C)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-20(2,3)26-19(24)23-9-10-27-18(23)11-17(15(12-21)13-22)14-5-7-16(25-4)8-6-14/h5-8,11H,9-10H2,1-4H3/b18-11- |
| InChIKey | MXVUIZQEMQGXSD-WQRHYEAKSA-N |
| XLogP | 4.32 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|