C21H21N3O2S — CID 15324485
tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methylphenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate (PubChem CID 15324485) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methylphenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methylphenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15324485 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl (2Z)-2-[3,3-dicyano-2-(4-methylphenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)/C(=C/C(=C(C#N)C#N)c2ccc(C)cc2)S1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14-6-8-16(9-7-14)18(17(11-22)12-23)10-19-24(13-15(2)27-19)20(25)26-21(3,4)5/h6-10H,2,13H2,1,3-5H3/b19-10- |
| InChIKey | YEGWGKPVZJMUBZ-GRSHGNNSSA-N |
| XLogP | 5.13 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|