C20H17F3N4O2S — CID 10670462
tert-butyl 2-[2,2-dicyano-1-[3-(trifluoromethyl)phenyl]ethenyl]imino-5-methylidene-1,3-thiazolidine-3-carboxylate (PubChem CID 10670462) has the molecular formula C20H17F3N4O2S and a molecular weight of 434.44 g/mol. Its IUPAC name is tert-butyl 2-[2,2-dicyano-1-[3-(trifluoromethyl)phenyl]ethenyl]imino-5-methylidene-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl 2-[2,2-dicyano-1-[3-(trifluoromethyl)phenyl]ethenyl]imino-5-methylidene-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10670462 |
| Molecular Formula | C20H17F3N4O2S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | tert-butyl 2-[2,2-dicyano-1-[3-(trifluoromethyl)phenyl]ethenyl]imino-5-methylidene-1,3-thiazolidine-3-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)/C(=N/C(=C(C#N)C#N)c2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C20H17F3N4O2S/c1-12-11-27(18(28)29-19(2,3)4)17(30-12)26-16(14(9-24)10-25)13-6-5-7-15(8-13)20(21,22)23/h5-8H,1,11H2,2-4H3/b26-17- |
| InChIKey | PIZVIOMKJHTQPM-ONUIUJJFSA-N |
| XLogP | 5.32 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|