C18H23F3N2O4 — CID 166449824
tert-butyl 3-(hydroxymethyl)-4-[3-(trifluoromethyl)benzoyl]piperazine-1-carboxylate (PubChem CID 166449824) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-4-[3-(trifluoromethyl)benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-4-[3-(trifluoromethyl)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166449824 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-4-[3-(trifluoromethyl)benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cccc(C(F)(F)F)c2)C(CO)C1 |
| InChI | InChI=1S/C18H23F3N2O4/c1-17(2,3)27-16(26)22-7-8-23(14(10-22)11-24)15(25)12-5-4-6-13(9-12)18(19,20)21/h4-6,9,14,24H,7-8,10-11H2,1-3H3 |
| InChIKey | DVZRFJDFJBPXFN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |