C21H21F3N2O4S — CID 55747004
[4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 55747004) has the molecular formula C21H21F3N2O4S and a molecular weight of 454.47 g/mol. Its IUPAC name is [4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 55747004 |
| Molecular Formula | C21H21F3N2O4S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N1CCN(C(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H21F3N2O4S/c1-2-31(29,30)18-9-4-3-8-17(18)20(28)26-12-10-25(11-13-26)19(27)15-6-5-7-16(14-15)21(22,23)24/h3-9,14H,2,10-13H2,1H3 |
| InChIKey | CGJYJPSZJFEQSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |