C13H14F3NO3S — CID 121164314
(3-ethylsulfonylazetidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 121164314) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is (3-ethylsulfonylazetidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | (3-ethylsulfonylazetidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 121164314 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (3-ethylsulfonylazetidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CCS(=O)(=O)C1CN(C(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H14F3NO3S/c1-2-21(19,20)11-7-17(8-11)12(18)9-4-3-5-10(6-9)13(14,15)16/h3-6,11H,2,7-8H2,1H3 |
| InChIKey | IVLYUNLAUOGQRP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |