C20H18N4O4S — CID 10787705
tert-butyl (2E)-2-[3,3-dicyano-2-(4-nitrophenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate (PubChem CID 10787705) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is tert-butyl (2E)-2-[3,3-dicyano-2-(4-nitrophenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2E)-2-[3,3-dicyano-2-(4-nitrophenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10787705 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | tert-butyl (2E)-2-[3,3-dicyano-2-(4-nitrophenyl)prop-2-enylidene]-5-methylidene-1,3-thiazolidine-3-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)/C(=C\C(=C(C#N)C#N)c2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C20H18N4O4S/c1-13-12-23(19(25)28-20(2,3)4)18(29-13)9-17(15(10-21)11-22)14-5-7-16(8-6-14)24(26)27/h5-9H,1,12H2,2-4H3/b18-9+ |
| InChIKey | ODGHQCHSTGYLTO-GIJQJNRQSA-N |
| XLogP | 4.73 |
| TPSA | 120.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|