C19H18ClN3O2S — CID 10524293
tert-butyl (2Z)-2-[2-(4-chlorophenyl)-3,3-dicyanoprop-2-enylidene]-1,3-thiazolidine-3-carboxylate (PubChem CID 10524293) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[2-(4-chlorophenyl)-3,3-dicyanoprop-2-enylidene]-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2Z)-2-[2-(4-chlorophenyl)-3,3-dicyanoprop-2-enylidene]-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10524293 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | tert-butyl (2Z)-2-[2-(4-chlorophenyl)-3,3-dicyanoprop-2-enylidene]-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCS/C1=C\C(=C(C#N)C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-19(2,3)25-18(24)23-8-9-26-17(23)10-16(14(11-21)12-22)13-4-6-15(20)7-5-13/h4-7,10H,8-9H2,1-3H3/b17-10- |
| InChIKey | OBBICCVLVYOBHY-YVLHZVERSA-N |
| XLogP | 4.97 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|