C16H18N2O4S2 — CID 10761422
tert-butyl (2E)-2-[benzenesulfonyl(cyano)methylidene]-1,3-thiazolidine-3-carboxylate (PubChem CID 10761422) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl (2E)-2-[benzenesulfonyl(cyano)methylidene]-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2E)-2-[benzenesulfonyl(cyano)methylidene]-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10761422 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | tert-butyl (2E)-2-[benzenesulfonyl(cyano)methylidene]-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCS/C1=C(\C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-16(2,3)22-15(19)18-9-10-23-14(18)13(11-17)24(20,21)12-7-5-4-6-8-12/h4-8H,9-10H2,1-3H3/b14-13+ |
| InChIKey | VAVQVYIUYNNDAR-BUHFOSPRSA-N |
| XLogP | 3.14 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|