C15H18N2O2 — CID 83445612
tert-butyl 8-cyano-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 83445612) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl 8-cyano-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-cyano-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 83445612 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | tert-butyl 8-cyano-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2cccc(C#N)c21 |
| InChI | InChI=1S/C15H18N2O2/c1-15(2,3)19-14(18)17-9-5-8-11-6-4-7-12(10-16)13(11)17/h4,6-7H,5,8-9H2,1-3H3 |
| InChIKey | BDFYOZVGSCZPFO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |