C15H21N3O2 — CID 168530055
tert-butyl 8-methanehydrazonoyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 168530055) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl 8-methanehydrazonoyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-methanehydrazonoyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 168530055 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl 8-methanehydrazonoyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2cccc(C=NN)c21 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,3)20-14(19)18-9-5-8-11-6-4-7-12(10-17-16)13(11)18/h4,6-7,10H,5,8-9,16H2,1-3H3 |
| InChIKey | KIZXLMAAOCWRCI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|