C16H20N2O2 — CID 130269109
tert-butyl 7-cyano-3,3-dimethyl-2H-indole-1-carboxylate (PubChem CID 130269109) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is tert-butyl 7-cyano-3,3-dimethyl-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 7-cyano-3,3-dimethyl-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 130269109 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | tert-butyl 7-cyano-3,3-dimethyl-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2cccc(C#N)c21 |
| InChI | InChI=1S/C16H20N2O2/c1-15(2,3)20-14(19)18-10-16(4,5)12-8-6-7-11(9-17)13(12)18/h6-8H,10H2,1-5H3 |
| InChIKey | LLHKAKOGABRFCV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |