C15H19BrN2O4 — CID 82490367
tert-butyl 5-bromo-3,3-dimethyl-7-nitro-2H-indole-1-carboxylate (PubChem CID 82490367) has the molecular formula C15H19BrN2O4 and a molecular weight of 371.23 g/mol. Its IUPAC name is tert-butyl 5-bromo-3,3-dimethyl-7-nitro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 5-bromo-3,3-dimethyl-7-nitro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 82490367 |
| Molecular Formula | C15H19BrN2O4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | tert-butyl 5-bromo-3,3-dimethyl-7-nitro-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2cc(Br)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C15H19BrN2O4/c1-14(2,3)22-13(19)17-8-15(4,5)10-6-9(16)7-11(12(10)17)18(20)21/h6-7H,8H2,1-5H3 |
| InChIKey | KEZXQVXUDAZWQA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|