C12H13BrClNO2 — CID 82490290
methyl 7-bromo-5-chloro-3,3-dimethyl-2H-indole-1-carboxylate (PubChem CID 82490290) has the molecular formula C12H13BrClNO2 and a molecular weight of 318.60 g/mol. Its IUPAC name is methyl 7-bromo-5-chloro-3,3-dimethyl-2H-indole-1-carboxylate.
| Compound Name | methyl 7-bromo-5-chloro-3,3-dimethyl-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 82490290 |
| Molecular Formula | C12H13BrClNO2 |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | methyl 7-bromo-5-chloro-3,3-dimethyl-2H-indole-1-carboxylate |
| SMILES | COC(=O)N1CC(C)(C)c2cc(Cl)cc(Br)c21 |
| InChI | InChI=1S/C12H13BrClNO2/c1-12(2)6-15(11(16)17-3)10-8(12)4-7(14)5-9(10)13/h4-5H,6H2,1-3H3 |
| InChIKey | MEIYAMCXVSDKKI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |