C8H5BrCl2O2 — CID 57362641
methyl 3-bromo-2,5-dichlorobenzoate (PubChem CID 57362641) has the molecular formula C8H5BrCl2O2 and a molecular weight of 283.94 g/mol. Its IUPAC name is methyl 3-bromo-2,5-dichlorobenzoate.
| Compound Name | methyl 3-bromo-2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 57362641 |
| Molecular Formula | C8H5BrCl2O2 |
| Molecular Weight | 283.94 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | methyl 3-bromo-2,5-dichlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(Br)c1Cl |
| InChI | InChI=1S/C8H5BrCl2O2/c1-13-8(12)5-2-4(10)3-6(9)7(5)11/h2-3H,1H3 |
| InChIKey | OHMVBWKRRWAFOK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|