C7H4BrCl2NO — CID 131599127
3-bromo-2,5-dichlorobenzamide (PubChem CID 131599127) has the molecular formula C7H4BrCl2NO and a molecular weight of 268.93 g/mol. Its IUPAC name is 3-bromo-2,5-dichlorobenzamide.
| Compound Name | 3-bromo-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 131599127 |
| Molecular Formula | C7H4BrCl2NO |
| Molecular Weight | 268.93 g/mol |
| Exact Mass | 266.89 |
| IUPAC Name | 3-bromo-2,5-dichlorobenzamide |
| SMILES | NC(=O)c1cc(Cl)cc(Br)c1Cl |
| InChI | InChI=1S/C7H4BrCl2NO/c8-5-2-3(9)1-4(6(5)10)7(11)12/h1-2H,(H2,11,12) |
| InChIKey | AHWZOSTXRFNDGS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.93 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|