C7H3BrCl2FNO — CID 141400879
3-bromo-2,6-dichloro-5-fluorobenzamide (PubChem CID 141400879) has the molecular formula C7H3BrCl2FNO and a molecular weight of 286.92 g/mol. Its IUPAC name is 3-bromo-2,6-dichloro-5-fluorobenzamide.
| Compound Name | 3-bromo-2,6-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 141400879 |
| Molecular Formula | C7H3BrCl2FNO |
| Molecular Weight | 286.92 g/mol |
| Exact Mass | 284.88 |
| IUPAC Name | 3-bromo-2,6-dichloro-5-fluorobenzamide |
| SMILES | NC(=O)c1c(Cl)c(F)cc(Br)c1Cl |
| InChI | InChI=1S/C7H3BrCl2FNO/c8-2-1-3(11)6(10)4(5(2)9)7(12)13/h1H,(H2,12,13) |
| InChIKey | SVAZSIJMZJISLI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.92 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|