C7H3BrF2N2O3 — CID 118338248
4-bromo-2,6-difluoro-3-nitrobenzamide (PubChem CID 118338248) has the molecular formula C7H3BrF2N2O3 and a molecular weight of 281.01 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-3-nitrobenzamide.
| Compound Name | 4-bromo-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 118338248 |
| Molecular Formula | C7H3BrF2N2O3 |
| Molecular Weight | 281.01 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | 4-bromo-2,6-difluoro-3-nitrobenzamide |
| SMILES | NC(=O)c1c(F)cc(Br)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C7H3BrF2N2O3/c8-2-1-3(9)4(7(11)13)5(10)6(2)12(14)15/h1H,(H2,11,13) |
| InChIKey | KOEMGYBWDKVOAL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.01 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|