C8H6F2N2O3 — CID 169268617
2,5-difluoro-4-methyl-3-nitrobenzamide (PubChem CID 169268617) has the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. Its IUPAC name is 2,5-difluoro-4-methyl-3-nitrobenzamide.
| Compound Name | 2,5-difluoro-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 169268617 |
| Molecular Formula | C8H6F2N2O3 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2,5-difluoro-4-methyl-3-nitrobenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6F2N2O3/c1-3-5(9)2-4(8(11)13)6(10)7(3)12(14)15/h2H,1H3,(H2,11,13) |
| InChIKey | QOQOXWYTGLEZNZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|