C8H5F3N2O2 — CID 87161201
2,3,5-trifluorobenzene-1,4-dicarboxamide (PubChem CID 87161201) has the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. Its IUPAC name is 2,3,5-trifluorobenzene-1,4-dicarboxamide.
| Compound Name | 2,3,5-trifluorobenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 87161201 |
| Molecular Formula | C8H5F3N2O2 |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2,3,5-trifluorobenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1cc(F)c(C(N)=O)c(F)c1F |
| InChI | InChI=1S/C8H5F3N2O2/c9-3-1-2(7(12)14)5(10)6(11)4(3)8(13)15/h1H,(H2,12,14)(H2,13,15) |
| InChIKey | BLPXIRBDUNKPML-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|