C7H3Br2F2NO — CID 119007128
2,4-dibromo-3,5-difluorobenzamide (PubChem CID 119007128) has the molecular formula C7H3Br2F2NO and a molecular weight of 314.91 g/mol. Its IUPAC name is 2,4-dibromo-3,5-difluorobenzamide.
| Compound Name | 2,4-dibromo-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 119007128 |
| Molecular Formula | C7H3Br2F2NO |
| Molecular Weight | 314.91 g/mol |
| Exact Mass | 312.85 |
| IUPAC Name | 2,4-dibromo-3,5-difluorobenzamide |
| SMILES | NC(=O)c1cc(F)c(Br)c(F)c1Br |
| InChI | InChI=1S/C7H3Br2F2NO/c8-4-2(7(12)13)1-3(10)5(9)6(4)11/h1H,(H2,12,13) |
| InChIKey | CWBBHDJJZMWSOO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.91 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|