C14H17NO4 — CID 101144422
dimethyl 3,3-dimethyl-2H-indole-1,5-dicarboxylate (PubChem CID 101144422) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-2H-indole-1,5-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-2H-indole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 101144422 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | dimethyl 3,3-dimethyl-2H-indole-1,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)CN2C(=O)OC |
| InChI | InChI=1S/C14H17NO4/c1-14(2)8-15(13(17)19-4)11-6-5-9(7-10(11)14)12(16)18-3/h5-7H,8H2,1-4H3 |
| InChIKey | MDNBSEHQXYVSCC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |