C13H15NO3 — CID 52911264
methyl 1,3,3-trimethyl-2-oxoindole-5-carboxylate (PubChem CID 52911264) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 1,3,3-trimethyl-2-oxoindole-5-carboxylate.
| Compound Name | methyl 1,3,3-trimethyl-2-oxoindole-5-carboxylate |
|---|---|
| PubChem CID | 52911264 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl 1,3,3-trimethyl-2-oxoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C13H15NO3/c1-13(2)9-7-8(11(15)17-4)5-6-10(9)14(3)12(13)16/h5-7H,1-4H3 |
| InChIKey | MGWJMLXPUZSJKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |