C12H15N3OS — CID 169359637
(1,3,3-trimethyl-2-oxoindol-5-yl)thiourea (PubChem CID 169359637) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is (1,3,3-trimethyl-2-oxoindol-5-yl)thiourea.
| Compound Name | (1,3,3-trimethyl-2-oxoindol-5-yl)thiourea |
|---|---|
| PubChem CID | 169359637 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1,3,3-trimethyl-2-oxoindol-5-yl)thiourea |
| SMILES | CN1C(=O)C(C)(C)c2cc(NC(N)=S)ccc21 |
| InChI | InChI=1S/C12H15N3OS/c1-12(2)8-6-7(14-11(13)17)4-5-9(8)15(3)10(12)16/h4-6H,1-3H3,(H3,13,14,17) |
| InChIKey | BZEFYCCIHDNUMU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|