C19H25N3O3 — CID 110742190
1-acetyl-N-(1,3,3-trimethyl-2-oxoindol-5-yl)piperidine-4-carboxamide (PubChem CID 110742190) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-acetyl-N-(1,3,3-trimethyl-2-oxoindol-5-yl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(1,3,3-trimethyl-2-oxoindol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110742190 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-acetyl-N-(1,3,3-trimethyl-2-oxoindol-5-yl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2ccc3c(c2)C(C)(C)C(=O)N3C)CC1 |
| InChI | InChI=1S/C19H25N3O3/c1-12(23)22-9-7-13(8-10-22)17(24)20-14-5-6-16-15(11-14)19(2,3)18(25)21(16)4/h5-6,11,13H,7-10H2,1-4H3,(H,20,24) |
| InChIKey | IQRPZVAWBDWVOQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |