C13H14BrNO3 — CID 156537382
methyl 5-bromo-1,3,3-trimethyl-2-oxoindole-6-carboxylate (PubChem CID 156537382) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is methyl 5-bromo-1,3,3-trimethyl-2-oxoindole-6-carboxylate.
| Compound Name | methyl 5-bromo-1,3,3-trimethyl-2-oxoindole-6-carboxylate |
|---|---|
| PubChem CID | 156537382 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | methyl 5-bromo-1,3,3-trimethyl-2-oxoindole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1Br)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C13H14BrNO3/c1-13(2)8-6-9(14)7(11(16)18-4)5-10(8)15(3)12(13)17/h5-6H,1-4H3 |
| InChIKey | LCLSHCORMMZZFW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |