C13H17NO3 — CID 82496589
5,6-dimethoxy-1,3,3-trimethylindol-2-one (PubChem CID 82496589) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 5,6-dimethoxy-1,3,3-trimethylindol-2-one.
| Compound Name | 5,6-dimethoxy-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 82496589 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5,6-dimethoxy-1,3,3-trimethylindol-2-one |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C13H17NO3/c1-13(2)8-6-10(16-4)11(17-5)7-9(8)14(3)12(13)15/h6-7H,1-5H3 |
| InChIKey | NVERHRPQQBCKRO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |