C19H19NO5 — CID 102310906
methyl (3S)-3-(3,4-dimethoxyphenyl)-1-methyl-2-oxoindole-3-carboxylate (PubChem CID 102310906) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl (3S)-3-(3,4-dimethoxyphenyl)-1-methyl-2-oxoindole-3-carboxylate.
| Compound Name | methyl (3S)-3-(3,4-dimethoxyphenyl)-1-methyl-2-oxoindole-3-carboxylate |
|---|---|
| PubChem CID | 102310906 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl (3S)-3-(3,4-dimethoxyphenyl)-1-methyl-2-oxoindole-3-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccc(OC)c(OC)c2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H19NO5/c1-20-14-8-6-5-7-13(14)19(17(20)21,18(22)25-4)12-9-10-15(23-2)16(11-12)24-3/h5-11H,1-4H3/t19-/m0/s1 |
| InChIKey | ZHBIHZDJERONAX-IBGZPJMESA-N |
| XLogP | 2.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|