C19H20N2O4S — CID 75767802
N-(3,4-dimethoxyphenyl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 75767802) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75767802 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)Sc3ccccc3N(C)C2=O)cc1OC |
| InChI | InChI=1S/C19H20N2O4S/c1-19(18(23)21(2)13-7-5-6-8-16(13)26-19)17(22)20-12-9-10-14(24-3)15(11-12)25-4/h5-11H,1-4H3,(H,20,22) |
| InChIKey | WEZAKBQYPLONQE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|