C17H15ClN2O3S — CID 75767649
N-(3-chloro-4-methoxyphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75767649) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75767649 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)Sc3ccccc3NC2=O)cc1Cl |
| InChI | InChI=1S/C17H15ClN2O3S/c1-17(16(22)20-12-5-3-4-6-14(12)24-17)15(21)19-10-7-8-13(23-2)11(18)9-10/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | JNKOVSLTGKQCNC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|