C16H13BrN2O2S — CID 75769200
N-(2-bromophenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75769200) has the molecular formula C16H13BrN2O2S and a molecular weight of 377.26 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75769200 |
| Molecular Formula | C16H13BrN2O2S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | N-(2-bromophenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC1(C(=O)Nc2ccccc2Br)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C16H13BrN2O2S/c1-16(14(20)18-11-7-3-2-6-10(11)17)15(21)19-12-8-4-5-9-13(12)22-16/h2-9H,1H3,(H,18,20)(H,19,21) |
| InChIKey | XGKHMPLZTSIUJI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|