C20H17N3O3S2 — CID 75769688
N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75769688) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75769688 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | COc1cccc(-c2csc(NC(=O)C3(C)Sc4ccccc4NC3=O)n2)c1 |
| InChI | InChI=1S/C20H17N3O3S2/c1-20(17(24)21-14-8-3-4-9-16(14)28-20)18(25)23-19-22-15(11-27-19)12-6-5-7-13(10-12)26-2/h3-11H,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | QSXOCNJGCXWBJN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|