C20H16ClN3O2S2 — CID 71690204
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 71690204) has the molecular formula C20H16ClN3O2S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 71690204 |
| Molecular Formula | C20H16ClN3O2S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC1(C(=O)NCc2nc(-c3ccc(Cl)cc3)cs2)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C20H16ClN3O2S2/c1-20(19(26)24-14-4-2-3-5-16(14)28-20)18(25)22-10-17-23-15(11-27-17)12-6-8-13(21)9-7-12/h2-9,11H,10H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | ULUWKDRSUVLKPS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|