C15H16N4O2S — CID 56686325
2-methyl-3-oxo-N-(2-pyrazol-1-ylethyl)-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 56686325) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(2-pyrazol-1-ylethyl)-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-(2-pyrazol-1-ylethyl)-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 56686325 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-methyl-3-oxo-N-(2-pyrazol-1-ylethyl)-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC1(C(=O)NCCn2cccn2)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C15H16N4O2S/c1-15(13(20)16-8-10-19-9-4-7-17-19)14(21)18-11-5-2-3-6-12(11)22-15/h2-7,9H,8,10H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | AEPKUKIJVXJKOZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|