C16H18N4O2S — CID 56686314
2-methyl-3-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 56686314) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 56686314 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-methyl-3-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)C1(C)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C16H18N4O2S/c1-9-13(10(2)20(4)19-9)18-15(22)16(3)14(21)17-11-7-5-6-8-12(11)23-16/h5-8H,1-4H3,(H,17,21)(H,18,22) |
| InChIKey | SPLYSSKVTUWDEE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|