C17H18N4O5 — CID 51720014
methyl 1,3-dimethyl-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]pyrazole-5-carboxylate (PubChem CID 51720014) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 1,3-dimethyl-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1,3-dimethyl-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 51720014 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | methyl 1,3-dimethyl-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)[C@@]2(C)Oc3ccccc3NC2=O)c(C)nn1C |
| InChI | InChI=1S/C17H18N4O5/c1-9-12(13(14(22)25-4)21(3)20-9)19-16(24)17(2)15(23)18-10-7-5-6-8-11(10)26-17/h5-8H,1-4H3,(H,18,23)(H,19,24)/t17-/m0/s1 |
| InChIKey | WVHJIKRDBHEKPB-KRWDZBQOSA-N |
| XLogP | 1.24 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|