C16H15N3O5S — CID 51720977
methyl 4-methyl-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 51720977) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is methyl 4-methyl-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 51720977 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | methyl 4-methyl-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)[C@@]2(C)Oc3ccccc3NC2=O)nc1C |
| InChI | InChI=1S/C16H15N3O5S/c1-8-11(12(20)23-3)25-15(17-8)19-14(22)16(2)13(21)18-9-6-4-5-7-10(9)24-16/h4-7H,1-3H3,(H,18,21)(H,17,19,22)/t16-/m0/s1 |
| InChIKey | MAXSLQWYRISMGM-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|