C19H16N4O3S — CID 75796173
2,6-dimethyl-3-oxo-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75796173) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2,6-dimethyl-3-oxo-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 2,6-dimethyl-3-oxo-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75796173 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2,6-dimethyl-3-oxo-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)Nc1nnc(-c3ccccc3)s1)O2 |
| InChI | InChI=1S/C19H16N4O3S/c1-11-8-9-14-13(10-11)20-16(24)19(2,26-14)17(25)21-18-23-22-15(27-18)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,20,24)(H,21,23,25) |
| InChIKey | KWSHVWGQYICIIX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|